C13H23F2N — CID 144886153
1-[(1R,3S)-3-ethylcyclohexyl]-4,4-difluoropiperidine (PubChem CID 144886153) has the molecular formula C13H23F2N and a molecular weight of 231.33 g/mol. Its IUPAC name is 1-[(1R,3S)-3-ethylcyclohexyl]-4,4-difluoropiperidine.
| Compound Name | 1-[(1R,3S)-3-ethylcyclohexyl]-4,4-difluoropiperidine |
|---|---|
| PubChem CID | 144886153 |
| Molecular Formula | C13H23F2N |
| Molecular Weight | 231.33 g/mol |
| Exact Mass | 231.18 |
| IUPAC Name | 1-[(1R,3S)-3-ethylcyclohexyl]-4,4-difluoropiperidine |
| SMILES | CC[C@H]1CCC[C@@H](N2CCC(F)(F)CC2)C1 |
| InChI | InChI=1S/C13H23F2N/c1-2-11-4-3-5-12(10-11)16-8-6-13(14,15)7-9-16/h11-12H,2-10H2,1H3/t11-,12+/m0/s1 |
| InChIKey | PJWDASPAKVKWLZ-NWDGAFQWSA-N |
| XLogP | 3.69 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 231.33 |
| LogP ≤ 5 | 3.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |