C14H28N2 — CID 166567337
1-(1-tert-butylazetidin-3-yl)-4,4-dimethylpiperidine (PubChem CID 166567337) has the molecular formula C14H28N2 and a molecular weight of 224.39 g/mol. Its IUPAC name is 1-(1-tert-butylazetidin-3-yl)-4,4-dimethylpiperidine.
| Compound Name | 1-(1-tert-butylazetidin-3-yl)-4,4-dimethylpiperidine |
|---|---|
| PubChem CID | 166567337 |
| Molecular Formula | C14H28N2 |
| Molecular Weight | 224.39 g/mol |
| Exact Mass | 224.23 |
| IUPAC Name | 1-(1-tert-butylazetidin-3-yl)-4,4-dimethylpiperidine |
| SMILES | CC1(C)CCN(C2CN(C(C)(C)C)C2)CC1 |
| InChI | InChI=1S/C14H28N2/c1-13(2,3)16-10-12(11-16)15-8-6-14(4,5)7-9-15/h12H,6-11H2,1-5H3 |
| InChIKey | UOARHCUGTCTIRI-UHFFFAOYSA-N |
| XLogP | 2.59 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 224.39 |
| LogP ≤ 5 | 2.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |