C12H22F2N2 — CID 167291973
1-[(3S)-1-tert-butylpyrrolidin-3-yl]-3,3-difluoropyrrolidine (PubChem CID 167291973) has the molecular formula C12H22F2N2 and a molecular weight of 232.32 g/mol. Its IUPAC name is 1-[(3S)-1-tert-butylpyrrolidin-3-yl]-3,3-difluoropyrrolidine.
| Compound Name | 1-[(3S)-1-tert-butylpyrrolidin-3-yl]-3,3-difluoropyrrolidine |
|---|---|
| PubChem CID | 167291973 |
| Molecular Formula | C12H22F2N2 |
| Molecular Weight | 232.32 g/mol |
| Exact Mass | 232.18 |
| IUPAC Name | 1-[(3S)-1-tert-butylpyrrolidin-3-yl]-3,3-difluoropyrrolidine |
| SMILES | CC(C)(C)N1CC[C@H](N2CCC(F)(F)C2)C1 |
| InChI | InChI=1S/C12H22F2N2/c1-11(2,3)16-6-4-10(8-16)15-7-5-12(13,14)9-15/h10H,4-9H2,1-3H3/t10-/m0/s1 |
| InChIKey | XRQONKFFZGVFBT-JTQLQIEISA-N |
| XLogP | 2.20 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 232.32 |
| LogP ≤ 5 | 2.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |