About 1-(1-tert-butylazetidin-3-yl)pyrrolidine;carbon dioxide;methane
1-(1-tert-butylazetidin-3-yl)pyrrolidine;carbon dioxide;methane (PubChem CID 161313953) has the molecular formula C13H26N2O2
and a molecular weight of 242.36 g/mol. Its IUPAC name is 1-(1-tert-butylazetidin-3-yl)pyrrolidine;carbon dioxide;methane.
Molecular Properties
| Compound Name | 1-(1-tert-butylazetidin-3-yl)pyrrolidine;carbon dioxide;methane |
| PubChem CID | 161313953 |
| Molecular Formula | C13H26N2O2 |
| Molecular Weight | 242.36 g/mol |
| Exact Mass | 242.20 |
| IUPAC Name | 1-(1-tert-butylazetidin-3-yl)pyrrolidine;carbon dioxide;methane |
| SMILES | C.CC(C)(C)N1CC(N2CCCC2)C1.O=C=O |
| InChI | InChI=1S/C11H22N2.CO2.CH4/c1-11(2,3)13-8-10(9-13)12-6-4-5-7-12;2-1-3;/h10H,4-9H2,1-3H3;;1H4 |
| InChIKey | VJGFOWBSBSBUGO-UHFFFAOYSA-N |
| XLogP | 1.62 |
| TPSA | 40.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 242.36 |
| LogP ≤ 5 | 1.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 1-(1-tert-butylazetidin-3-yl)pyrrolidine;carbon dioxide;methane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(1-tert-butylazetidin-3-yl)pyrrolidine;carbon dioxide;methane?
The IUPAC name of 1-(1-tert-butylazetidin-3-yl)pyrrolidine;carbon dioxide;methane (CID 161313953) is 1-(1-tert-butylazetidin-3-yl)pyrrolidine;carbon dioxide;methane.
What is the SMILES notation for 1-(1-tert-butylazetidin-3-yl)pyrrolidine;carbon dioxide;methane?
The canonical SMILES for 1-(1-tert-butylazetidin-3-yl)pyrrolidine;carbon dioxide;methane is C.CC(C)(C)N1CC(N2CCCC2)C1.O=C=O.
What is the InChIKey of 1-(1-tert-butylazetidin-3-yl)pyrrolidine;carbon dioxide;methane?
The InChIKey is VJGFOWBSBSBUGO-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H22N2.CO2.CH4/c1-11(2,3)13-8-10(9-13)12-6-4-5-7-12;2-1-3;/h10H,4-9H2,1-3H3;;1H4.
What are the key properties of 1-(1-tert-butylazetidin-3-yl)pyrrolidine;carbon dioxide;methane?
1-(1-tert-butylazetidin-3-yl)pyrrolidine;carbon dioxide;methane has a molecular weight of 242.36 g/mol, XLogP of 1.62, 1 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(1-tert-butylazetidin-3-yl)pyrrolidine;carbon dioxide;methane is sourced from PubChem (CID 161313953), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).