About 4-cyclohexylmorpholine;4-ethylmorpholine
4-cyclohexylmorpholine;4-ethylmorpholine (PubChem CID 90198575) has the molecular formula C16H32N2O2
and a molecular weight of 284.44 g/mol. Its IUPAC name is 4-cyclohexylmorpholine;4-ethylmorpholine.
Molecular Properties
| Compound Name | 4-cyclohexylmorpholine;4-ethylmorpholine |
| PubChem CID | 90198575 |
| Molecular Formula | C16H32N2O2 |
| Molecular Weight | 284.44 g/mol |
| Exact Mass | 284.25 |
| IUPAC Name | 4-cyclohexylmorpholine;4-ethylmorpholine |
| SMILES | C1CCC(N2CCOCC2)CC1.CCN1CCOCC1 |
| InChI | InChI=1S/C10H19NO.C6H13NO/c1-2-4-10(5-3-1)11-6-8-12-9-7-11;1-2-7-3-5-8-6-4-7/h10H,1-9H2;2-6H2,1H3 |
| InChIKey | CKOBQXJLDUNHHV-UHFFFAOYSA-N |
| XLogP | 1.99 |
| TPSA | 24.94 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 284.44 |
| LogP ≤ 5 | 1.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 4-cyclohexylmorpholine;4-ethylmorpholine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-cyclohexylmorpholine;4-ethylmorpholine?
The IUPAC name of 4-cyclohexylmorpholine;4-ethylmorpholine (CID 90198575) is 4-cyclohexylmorpholine;4-ethylmorpholine.
What is the SMILES notation for 4-cyclohexylmorpholine;4-ethylmorpholine?
The canonical SMILES for 4-cyclohexylmorpholine;4-ethylmorpholine is C1CCC(N2CCOCC2)CC1.CCN1CCOCC1.
What is the InChIKey of 4-cyclohexylmorpholine;4-ethylmorpholine?
The InChIKey is CKOBQXJLDUNHHV-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H19NO.C6H13NO/c1-2-4-10(5-3-1)11-6-8-12-9-7-11;1-2-7-3-5-8-6-4-7/h10H,1-9H2;2-6H2,1H3.
What are the key properties of 4-cyclohexylmorpholine;4-ethylmorpholine?
4-cyclohexylmorpholine;4-ethylmorpholine has a molecular weight of 284.44 g/mol, XLogP of 1.99, 2 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 4-cyclohexylmorpholine;4-ethylmorpholine is sourced from PubChem (CID 90198575), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).