About 1-cyclopropyl-4-methylpiperazine;ethane;4-methylmorpholine
1-cyclopropyl-4-methylpiperazine;ethane;4-methylmorpholine (PubChem CID 142483010) has the molecular formula C19H45N3O
and a molecular weight of 331.59 g/mol. Its IUPAC name is 1-cyclopropyl-4-methylpiperazine;ethane;4-methylmorpholine.
Molecular Properties
| Compound Name | 1-cyclopropyl-4-methylpiperazine;ethane;4-methylmorpholine |
| PubChem CID | 142483010 |
| Molecular Formula | C19H45N3O |
| Molecular Weight | 331.59 g/mol |
| Exact Mass | 331.36 |
| IUPAC Name | 1-cyclopropyl-4-methylpiperazine;ethane;4-methylmorpholine |
| SMILES | CC.CC.CC.CN1CCN(C2CC2)CC1.CN1CCOCC1 |
| InChI | InChI=1S/C8H16N2.C5H11NO.3C2H6/c1-9-4-6-10(7-5-9)8-2-3-8;1-6-2-4-7-5-3-6;3*1-2/h8H,2-7H2,1H3;2-5H2,1H3;3*1-2H3 |
| InChIKey | NTUSELNUJMVAFS-UHFFFAOYSA-N |
| XLogP | 3.42 |
| TPSA | 18.95 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 331.59 |
| LogP ≤ 5 | 3.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 1-cyclopropyl-4-methylpiperazine;ethane;4-methylmorpholine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-cyclopropyl-4-methylpiperazine;ethane;4-methylmorpholine?
The IUPAC name of 1-cyclopropyl-4-methylpiperazine;ethane;4-methylmorpholine (CID 142483010) is 1-cyclopropyl-4-methylpiperazine;ethane;4-methylmorpholine.
What is the SMILES notation for 1-cyclopropyl-4-methylpiperazine;ethane;4-methylmorpholine?
The canonical SMILES for 1-cyclopropyl-4-methylpiperazine;ethane;4-methylmorpholine is CC.CC.CC.CN1CCN(C2CC2)CC1.CN1CCOCC1.
What is the InChIKey of 1-cyclopropyl-4-methylpiperazine;ethane;4-methylmorpholine?
The InChIKey is NTUSELNUJMVAFS-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H16N2.C5H11NO.3C2H6/c1-9-4-6-10(7-5-9)8-2-3-8;1-6-2-4-7-5-3-6;3*1-2/h8H,2-7H2,1H3;2-5H2,1H3;3*1-2H3.
What are the key properties of 1-cyclopropyl-4-methylpiperazine;ethane;4-methylmorpholine?
1-cyclopropyl-4-methylpiperazine;ethane;4-methylmorpholine has a molecular weight of 331.59 g/mol, XLogP of 3.42, 1 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1-cyclopropyl-4-methylpiperazine;ethane;4-methylmorpholine is sourced from PubChem (CID 142483010), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).