C20H42N4O4 — CID 174301861
4,13-dimethyl-7,10,19,24-tetraoxa-1,4,13,16-tetrazabicyclo[14.5.5]hexacosane (PubChem CID 174301861) has the molecular formula C20H42N4O4 and a molecular weight of 402.58 g/mol. Its IUPAC name is 4,13-dimethyl-7,10,19,24-tetraoxa-1,4,13,16-tetrazabicyclo[14.5.5]hexacosane.
| Compound Name | 4,13-dimethyl-7,10,19,24-tetraoxa-1,4,13,16-tetrazabicyclo[14.5.5]hexacosane |
|---|---|
| PubChem CID | 174301861 |
| Molecular Formula | C20H42N4O4 |
| Molecular Weight | 402.58 g/mol |
| Exact Mass | 402.32 |
| IUPAC Name | 4,13-dimethyl-7,10,19,24-tetraoxa-1,4,13,16-tetrazabicyclo[14.5.5]hexacosane |
| SMILES | CN1CCOCCOCCN(C)CCN2CCOCCN(CCOCC2)CC1 |
| InChI | InChI=1S/C20H42N4O4/c1-21-3-5-23-9-15-25-17-11-24(12-18-26-16-10-23)6-4-22(2)8-14-28-20-19-27-13-7-21/h3-20H2,1-2H3 |
| InChIKey | GAPDRGHPSWCEMX-UHFFFAOYSA-N |
| XLogP | -0.45 |
| TPSA | 49.88 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.58 |
| LogP ≤ 5 | -0.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'crown_ether', 'substructure': 'N/A'} |
|---|