C24H42N4O4 — CID 174302354
17,23-dimethyl-4,11,20,28-tetraoxa-1,14,17,23-tetrazatricyclo[12.11.5.05,10]triaconta-5,7,9-triene (PubChem CID 174302354) has the molecular formula C24H42N4O4 and a molecular weight of 450.62 g/mol. Its IUPAC name is 17,23-dimethyl-4,11,20,28-tetraoxa-1,14,17,23-tetrazatricyclo[12.11.5.05,10]triaconta-5,7,9-triene.
| Compound Name | 17,23-dimethyl-4,11,20,28-tetraoxa-1,14,17,23-tetrazatricyclo[12.11.5.05,10]triaconta-5,7,9-triene |
|---|---|
| PubChem CID | 174302354 |
| Molecular Formula | C24H42N4O4 |
| Molecular Weight | 450.62 g/mol |
| Exact Mass | 450.32 |
| IUPAC Name | 17,23-dimethyl-4,11,20,28-tetraoxa-1,14,17,23-tetrazatricyclo[12.11.5.05,10]triaconta-5,7,9-triene |
| SMILES | CN1CCOCCN(C)CCN2CCOCCN(CCOc3ccccc3OCC2)CC1 |
| InChI | InChI=1S/C24H42N4O4/c1-25-7-9-27-13-19-30-20-14-28(10-8-26(2)12-18-29-17-11-25)16-22-32-24-6-4-3-5-23(24)31-21-15-27/h3-6H,7-22H2,1-2H3 |
| InChIKey | DAFQDGJKQPVKQZ-UHFFFAOYSA-N |
| XLogP | 0.97 |
| TPSA | 49.88 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.62 |
| LogP ≤ 5 | 0.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'crown_ether', 'substructure': 'N/A'} |
|---|