C21H36N4O3 — CID 174302146
4,11,26-trioxa-1,14,17,21-tetrazatricyclo[12.9.5.05,10]octacosa-5,7,9-triene (PubChem CID 174302146) has the molecular formula C21H36N4O3 and a molecular weight of 392.54 g/mol. Its IUPAC name is 4,11,26-trioxa-1,14,17,21-tetrazatricyclo[12.9.5.05,10]octacosa-5,7,9-triene.
| Compound Name | 4,11,26-trioxa-1,14,17,21-tetrazatricyclo[12.9.5.05,10]octacosa-5,7,9-triene |
|---|---|
| PubChem CID | 174302146 |
| Molecular Formula | C21H36N4O3 |
| Molecular Weight | 392.54 g/mol |
| Exact Mass | 392.28 |
| IUPAC Name | 4,11,26-trioxa-1,14,17,21-tetrazatricyclo[12.9.5.05,10]octacosa-5,7,9-triene |
| SMILES | c1ccc2c(c1)OCCN1CCNCCCNCCN(CCOCC1)CCO2 |
| InChI | InChI=1S/C21H36N4O3/c1-2-5-21-20(4-1)27-18-14-24-10-8-22-6-3-7-23-9-11-25(15-19-28-21)13-17-26-16-12-24/h1-2,4-5,22-23H,3,6-19H2 |
| InChIKey | OBLRDCOKHOOGRH-UHFFFAOYSA-N |
| XLogP | 0.66 |
| TPSA | 58.23 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.54 |
| LogP ≤ 5 | 0.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'crown_ether', 'substructure': 'N/A'} |
|---|