C44H82N8O7 — CID 174304346
(16S)-16-(4,10-dimethyl-7,17,20,23-tetraoxa-1,4,10,14-tetrazabicyclo[12.11.2]heptacosan-12-yl)-17,21-dimethyl-4,11,26-trioxa-1,14,17,21-tetrazatricyclo[12.9.5.05,10]octacosa-5,7,9-triene (PubChem CID 174304346) has the molecular formula C44H82N8O7 and a molecular weight of 835.19 g/mol. Its IUPAC name is (16S)-16-(4,10-dimethyl-7,17,20,23-tetraoxa-1,4,10,14-tetrazabicyclo[12.11.2]heptacosan-12-yl)-17,21-dimethyl-4,11,26-trioxa-1,14,17,21-tetrazatricyclo[12.9.5.05,10]octacosa-5,7,9-triene.
| Compound Name | (16S)-16-(4,10-dimethyl-7,17,20,23-tetraoxa-1,4,10,14-tetrazabicyclo[12.11.2]heptacosan-12-yl)-17,21-dimethyl-4,11,26-trioxa-1,14,17,21-tetrazatricyclo[12.9.5.05,10]octacosa-5,7,9-triene |
|---|---|
| PubChem CID | 174304346 |
| Molecular Formula | C44H82N8O7 |
| Molecular Weight | 835.19 g/mol |
| Exact Mass | 834.63 |
| IUPAC Name | (16S)-16-(4,10-dimethyl-7,17,20,23-tetraoxa-1,4,10,14-tetrazabicyclo[12.11.2]heptacosan-12-yl)-17,21-dimethyl-4,11,26-trioxa-1,14,17,21-tetrazatricyclo[12.9.5.05,10]octacosa-5,7,9-triene |
| SMILES | CN1CCCN(C)[C@@H](C2CN(C)CCOCCN(C)CCN3CCOCCOCCOCCN(CC3)C2)CN2CCOCCN(CCOc3ccccc3OCC2)CC1 |
| InChI | InChI=1S/C44H82N8O7/c1-45-10-7-11-48(4)42(40-52-23-30-54-28-21-50(15-12-45)24-32-58-43-8-5-6-9-44(43)59-33-25-52)41-38-47(3)19-27-53-26-18-46(2)13-14-49-16-17-51(39-41)22-31-56-35-37-57-36-34-55-29-20-49/h5-6,8-9,41-42H,7,10-40H2,1-4H3/t41?,42-/m1/s1 |
| InChIKey | UHMVILWLVAMSRQ-FBUHDGFBSA-N |
| XLogP | 0.89 |
| TPSA | 90.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 15 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 59 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 835.19 |
| LogP ≤ 5 | 0.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 15 |
| Structural Alerts | {'alert_name': 'crown_ether', 'substructure': 'N/A'} |
|---|