About 9H-fluorene;4-methylmorpholine
9H-fluorene;4-methylmorpholine (PubChem CID 158477262) has the molecular formula C18H21NO
and a molecular weight of 267.37 g/mol. Its IUPAC name is 9H-fluorene;4-methylmorpholine.
Molecular Properties
| Compound Name | 9H-fluorene;4-methylmorpholine |
| PubChem CID | 158477262 |
| Molecular Formula | C18H21NO |
| Molecular Weight | 267.37 g/mol |
| Exact Mass | 267.16 |
| IUPAC Name | 9H-fluorene;4-methylmorpholine |
| SMILES | CN1CCOCC1.c1ccc2c(c1)Cc1ccccc1-2 |
| InChI | InChI=1S/C13H10.C5H11NO/c1-3-7-12-10(5-1)9-11-6-2-4-8-13(11)12;1-6-2-4-7-5-3-6/h1-8H,9H2;2-5H2,1H3 |
| InChIKey | HHBYLLBMJKICHG-UHFFFAOYSA-N |
| XLogP | 3.21 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 267.37 |
| LogP ≤ 5 | 3.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 9H-fluorene;4-methylmorpholine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 9H-fluorene;4-methylmorpholine?
The IUPAC name of 9H-fluorene;4-methylmorpholine (CID 158477262) is 9H-fluorene;4-methylmorpholine.
What is the SMILES notation for 9H-fluorene;4-methylmorpholine?
The canonical SMILES for 9H-fluorene;4-methylmorpholine is CN1CCOCC1.c1ccc2c(c1)Cc1ccccc1-2.
What is the InChIKey of 9H-fluorene;4-methylmorpholine?
The InChIKey is HHBYLLBMJKICHG-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H10.C5H11NO/c1-3-7-12-10(5-1)9-11-6-2-4-8-13(11)12;1-6-2-4-7-5-3-6/h1-8H,9H2;2-5H2,1H3.
What are the key properties of 9H-fluorene;4-methylmorpholine?
9H-fluorene;4-methylmorpholine has a molecular weight of 267.37 g/mol, XLogP of 3.21, 0 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 9H-fluorene;4-methylmorpholine is sourced from PubChem (CID 158477262), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).