About 4-ethylmorpholine;9H-fluorene
4-ethylmorpholine;9H-fluorene (PubChem CID 159014323) has the molecular formula C19H23NO
and a molecular weight of 281.40 g/mol. Its IUPAC name is 4-ethylmorpholine;9H-fluorene.
Molecular Properties
| Compound Name | 4-ethylmorpholine;9H-fluorene |
| PubChem CID | 159014323 |
| Molecular Formula | C19H23NO |
| Molecular Weight | 281.40 g/mol |
| Exact Mass | 281.18 |
| IUPAC Name | 4-ethylmorpholine;9H-fluorene |
| SMILES | CCN1CCOCC1.c1ccc2c(c1)Cc1ccccc1-2 |
| InChI | InChI=1S/C13H10.C6H13NO/c1-3-7-12-10(5-1)9-11-6-2-4-8-13(11)12;1-2-7-3-5-8-6-4-7/h1-8H,9H2;2-6H2,1H3 |
| InChIKey | JSWWNXDSVGLGKK-UHFFFAOYSA-N |
| XLogP | 3.60 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 281.40 |
| LogP ≤ 5 | 3.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 4-ethylmorpholine;9H-fluorene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-ethylmorpholine;9H-fluorene?
The IUPAC name of 4-ethylmorpholine;9H-fluorene (CID 159014323) is 4-ethylmorpholine;9H-fluorene.
What is the SMILES notation for 4-ethylmorpholine;9H-fluorene?
The canonical SMILES for 4-ethylmorpholine;9H-fluorene is CCN1CCOCC1.c1ccc2c(c1)Cc1ccccc1-2.
What is the InChIKey of 4-ethylmorpholine;9H-fluorene?
The InChIKey is JSWWNXDSVGLGKK-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H10.C6H13NO/c1-3-7-12-10(5-1)9-11-6-2-4-8-13(11)12;1-2-7-3-5-8-6-4-7/h1-8H,9H2;2-6H2,1H3.
What are the key properties of 4-ethylmorpholine;9H-fluorene?
4-ethylmorpholine;9H-fluorene has a molecular weight of 281.40 g/mol, XLogP of 3.60, 1 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 4-ethylmorpholine;9H-fluorene is sourced from PubChem (CID 159014323), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).