C13H19NO — CID 174270382
bicyclo[2.2.1]hepta-1,3,5-triene;4-ethylmorpholine (PubChem CID 174270382) has the molecular formula C13H19NO and a molecular weight of 205.30 g/mol. Its IUPAC name is bicyclo[2.2.1]hepta-1,3,5-triene;4-ethylmorpholine.
| Compound Name | bicyclo[2.2.1]hepta-1,3,5-triene;4-ethylmorpholine |
|---|---|
| PubChem CID | 174270382 |
| Molecular Formula | C13H19NO |
| Molecular Weight | 205.30 g/mol |
| Exact Mass | 205.15 |
| IUPAC Name | bicyclo[2.2.1]hepta-1,3,5-triene;4-ethylmorpholine |
| SMILES | C1=CC2=CC=C1C2.CCN1CCOCC1 |
| InChI | InChI=1S/C7H6.C6H13NO/c1-2-7-4-3-6(1)5-7;1-2-7-3-5-8-6-4-7/h1-4H,5H2;2-6H2,1H3 |
| InChIKey | YZSKPWBNSWVFGN-UHFFFAOYSA-N |
| XLogP | 2.15 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 205.30 |
| LogP ≤ 5 | 2.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |