About 8-ethyl-1,4-dioxa-8-azaspiro[4.5]decane;4-ethylmorpholine
8-ethyl-1,4-dioxa-8-azaspiro[4.5]decane;4-ethylmorpholine (PubChem CID 91090838) has the molecular formula C15H30N2O3
and a molecular weight of 286.42 g/mol. Its IUPAC name is 8-ethyl-1,4-dioxa-8-azaspiro[4.5]decane;4-ethylmorpholine.
Molecular Properties
| Compound Name | 8-ethyl-1,4-dioxa-8-azaspiro[4.5]decane;4-ethylmorpholine |
| PubChem CID | 91090838 |
| Molecular Formula | C15H30N2O3 |
| Molecular Weight | 286.42 g/mol |
| Exact Mass | 286.23 |
| IUPAC Name | 8-ethyl-1,4-dioxa-8-azaspiro[4.5]decane;4-ethylmorpholine |
| SMILES | CCN1CCC2(CC1)OCCO2.CCN1CCOCC1 |
| InChI | InChI=1S/C9H17NO2.C6H13NO/c1-2-10-5-3-9(4-6-10)11-7-8-12-9;1-2-7-3-5-8-6-4-7/h2-8H2,1H3;2-6H2,1H3 |
| InChIKey | RPTCLGKTDYYIRI-UHFFFAOYSA-N |
| XLogP | 1.18 |
| TPSA | 34.17 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 286.42 |
| LogP ≤ 5 | 1.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 8-ethyl-1,4-dioxa-8-azaspiro[4.5]decane;4-ethylmorpholine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 8-ethyl-1,4-dioxa-8-azaspiro[4.5]decane;4-ethylmorpholine?
The IUPAC name of 8-ethyl-1,4-dioxa-8-azaspiro[4.5]decane;4-ethylmorpholine (CID 91090838) is 8-ethyl-1,4-dioxa-8-azaspiro[4.5]decane;4-ethylmorpholine.
What is the SMILES notation for 8-ethyl-1,4-dioxa-8-azaspiro[4.5]decane;4-ethylmorpholine?
The canonical SMILES for 8-ethyl-1,4-dioxa-8-azaspiro[4.5]decane;4-ethylmorpholine is CCN1CCC2(CC1)OCCO2.CCN1CCOCC1.
What is the InChIKey of 8-ethyl-1,4-dioxa-8-azaspiro[4.5]decane;4-ethylmorpholine?
The InChIKey is RPTCLGKTDYYIRI-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H17NO2.C6H13NO/c1-2-10-5-3-9(4-6-10)11-7-8-12-9;1-2-7-3-5-8-6-4-7/h2-8H2,1H3;2-6H2,1H3.
What are the key properties of 8-ethyl-1,4-dioxa-8-azaspiro[4.5]decane;4-ethylmorpholine?
8-ethyl-1,4-dioxa-8-azaspiro[4.5]decane;4-ethylmorpholine has a molecular weight of 286.42 g/mol, XLogP of 1.18, 2 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 8-ethyl-1,4-dioxa-8-azaspiro[4.5]decane;4-ethylmorpholine is sourced from PubChem (CID 91090838), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).