C12H25NO2 — CID 143370100
ethane;8-propyl-1,4-dioxa-8-azaspiro[4.5]decane (PubChem CID 143370100) has the molecular formula C12H25NO2 and a molecular weight of 215.34 g/mol. Its IUPAC name is ethane;8-propyl-1,4-dioxa-8-azaspiro[4.5]decane.
| Compound Name | ethane;8-propyl-1,4-dioxa-8-azaspiro[4.5]decane |
|---|---|
| PubChem CID | 143370100 |
| Molecular Formula | C12H25NO2 |
| Molecular Weight | 215.34 g/mol |
| Exact Mass | 215.19 |
| IUPAC Name | ethane;8-propyl-1,4-dioxa-8-azaspiro[4.5]decane |
| SMILES | CC.CCCN1CCC2(CC1)OCCO2 |
| InChI | InChI=1S/C10H19NO2.C2H6/c1-2-5-11-6-3-10(4-7-11)12-8-9-13-10;1-2/h2-9H2,1H3;1-2H3 |
| InChIKey | VRHRUYFGDPVMOM-UHFFFAOYSA-N |
| XLogP | 2.26 |
| TPSA | 21.70 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 215.34 |
| LogP ≤ 5 | 2.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |