C13H26NO5P — CID 42631926
8-(2-diethoxyphosphorylethyl)-1,4-dioxa-8-azaspiro[4.5]decane (PubChem CID 42631926) has the molecular formula C13H26NO5P and a molecular weight of 307.33 g/mol. Its IUPAC name is 8-(2-diethoxyphosphorylethyl)-1,4-dioxa-8-azaspiro[4.5]decane.
| Compound Name | 8-(2-diethoxyphosphorylethyl)-1,4-dioxa-8-azaspiro[4.5]decane |
|---|---|
| PubChem CID | 42631926 |
| Molecular Formula | C13H26NO5P |
| Molecular Weight | 307.33 g/mol |
| Exact Mass | 307.15 |
| IUPAC Name | 8-(2-diethoxyphosphorylethyl)-1,4-dioxa-8-azaspiro[4.5]decane |
| SMILES | CCOP(=O)(CCN1CCC2(CC1)OCCO2)OCC |
| InChI | InChI=1S/C13H26NO5P/c1-3-18-20(15,19-4-2)12-9-14-7-5-13(6-8-14)16-10-11-17-13/h3-12H2,1-2H3 |
| InChIKey | PPJCAWBLXNAOKM-UHFFFAOYSA-N |
| XLogP | 2.09 |
| TPSA | 57.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.33 |
| LogP ≤ 5 | 2.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|