C12H23NO4 — CID 79885602
8-[2-(2-methoxyethoxy)ethyl]-1,4-dioxa-8-azaspiro[4.5]decane (PubChem CID 79885602) has the molecular formula C12H23NO4 and a molecular weight of 245.32 g/mol. Its IUPAC name is 8-[2-(2-methoxyethoxy)ethyl]-1,4-dioxa-8-azaspiro[4.5]decane.
| Compound Name | 8-[2-(2-methoxyethoxy)ethyl]-1,4-dioxa-8-azaspiro[4.5]decane |
|---|---|
| PubChem CID | 79885602 |
| Molecular Formula | C12H23NO4 |
| Molecular Weight | 245.32 g/mol |
| Exact Mass | 245.16 |
| IUPAC Name | 8-[2-(2-methoxyethoxy)ethyl]-1,4-dioxa-8-azaspiro[4.5]decane |
| SMILES | COCCOCCN1CCC2(CC1)OCCO2 |
| InChI | InChI=1S/C12H23NO4/c1-14-8-9-15-7-6-13-4-2-12(3-5-13)16-10-11-17-12/h2-11H2,1H3 |
| InChIKey | KJKJELVJGLDXTN-UHFFFAOYSA-N |
| XLogP | 0.49 |
| TPSA | 40.16 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 245.32 |
| LogP ≤ 5 | 0.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|