C22H46N2O8 — CID 14910697
13,16-bis[2-(2-methoxyethoxy)ethyl]-1,4,7,10-tetraoxa-13,16-diazacyclooctadecane (PubChem CID 14910697) has the molecular formula C22H46N2O8 and a molecular weight of 466.62 g/mol. Its IUPAC name is 13,16-bis[2-(2-methoxyethoxy)ethyl]-1,4,7,10-tetraoxa-13,16-diazacyclooctadecane.
| Compound Name | 13,16-bis[2-(2-methoxyethoxy)ethyl]-1,4,7,10-tetraoxa-13,16-diazacyclooctadecane |
|---|---|
| PubChem CID | 14910697 |
| Molecular Formula | C22H46N2O8 |
| Molecular Weight | 466.62 g/mol |
| Exact Mass | 466.33 |
| IUPAC Name | 13,16-bis[2-(2-methoxyethoxy)ethyl]-1,4,7,10-tetraoxa-13,16-diazacyclooctadecane |
| SMILES | COCCOCCN1CCOCCOCCOCCOCCN(CCOCCOC)CC1 |
| InChI | InChI=1S/C22H46N2O8/c1-25-13-15-27-9-5-23-3-4-24(6-10-28-16-14-26-2)8-12-30-18-20-32-22-21-31-19-17-29-11-7-23/h3-22H2,1-2H3 |
| InChIKey | OVOHQYPRMILBMZ-UHFFFAOYSA-N |
| XLogP | -0.00 |
| TPSA | 80.32 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 466.62 |
| LogP ≤ 5 | -0.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|