C16H23NO3 — CID 130536954
8-(2-phenylmethoxyethyl)-1,4-dioxa-8-azaspiro[4.5]decane (PubChem CID 130536954) has the molecular formula C16H23NO3 and a molecular weight of 277.36 g/mol. Its IUPAC name is 8-(2-phenylmethoxyethyl)-1,4-dioxa-8-azaspiro[4.5]decane.
| Compound Name | 8-(2-phenylmethoxyethyl)-1,4-dioxa-8-azaspiro[4.5]decane |
|---|---|
| PubChem CID | 130536954 |
| Molecular Formula | C16H23NO3 |
| Molecular Weight | 277.36 g/mol |
| Exact Mass | 277.17 |
| IUPAC Name | 8-(2-phenylmethoxyethyl)-1,4-dioxa-8-azaspiro[4.5]decane |
| SMILES | c1ccc(COCCN2CCC3(CC2)OCCO3)cc1 |
| InChI | InChI=1S/C16H23NO3/c1-2-4-15(5-3-1)14-18-11-10-17-8-6-16(7-9-17)19-12-13-20-16/h1-5H,6-14H2 |
| InChIKey | WZNFDQXQZITDDA-UHFFFAOYSA-N |
| XLogP | 2.04 |
| TPSA | 30.93 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.36 |
| LogP ≤ 5 | 2.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|