About bis(3-[4-(2-phenylmethoxyethyl)piperazin-1-yl]propanoic acid);hydrate
bis(3-[4-(2-phenylmethoxyethyl)piperazin-1-yl]propanoic acid);hydrate (PubChem CID 156599366) has the molecular formula C32H50N4O7
and a molecular weight of 602.77 g/mol. Its IUPAC name is bis(3-[4-(2-phenylmethoxyethyl)piperazin-1-yl]propanoic acid);hydrate.
Molecular Properties
| Compound Name | bis(3-[4-(2-phenylmethoxyethyl)piperazin-1-yl]propanoic acid);hydrate |
| PubChem CID | 156599366 |
| Molecular Formula | C32H50N4O7 |
| Molecular Weight | 602.77 g/mol |
| Exact Mass | 602.37 |
| IUPAC Name | bis(3-[4-(2-phenylmethoxyethyl)piperazin-1-yl]propanoic acid);hydrate |
| SMILES | O.O=C(O)CCN1CCN(CCOCc2ccccc2)CC1.O=C(O)CCN1CCN(CCOCc2ccccc2)CC1 |
| InChI | InChI=1S/2C16H24N2O3.H2O/c2*19-16(20)6-7-17-8-10-18(11-9-17)12-13-21-14-15-4-2-1-3-5-15;/h2*1-5H,6-14H2,(H,19,20);1H2 |
| InChIKey | HTDPMHXZTKRXRL-UHFFFAOYSA-N |
| XLogP | 1.77 |
| TPSA | 137.52 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 43 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 602.77 |
| LogP ≤ 5 | 1.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze bis(3-[4-(2-phenylmethoxyethyl)piperazin-1-yl]propanoic acid);hydrate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of bis(3-[4-(2-phenylmethoxyethyl)piperazin-1-yl]propanoic acid);hydrate?
The IUPAC name of bis(3-[4-(2-phenylmethoxyethyl)piperazin-1-yl]propanoic acid);hydrate (CID 156599366) is bis(3-[4-(2-phenylmethoxyethyl)piperazin-1-yl]propanoic acid);hydrate.
What is the SMILES notation for bis(3-[4-(2-phenylmethoxyethyl)piperazin-1-yl]propanoic acid);hydrate?
The canonical SMILES for bis(3-[4-(2-phenylmethoxyethyl)piperazin-1-yl]propanoic acid);hydrate is O.O=C(O)CCN1CCN(CCOCc2ccccc2)CC1.O=C(O)CCN1CCN(CCOCc2ccccc2)CC1.
What is the InChIKey of bis(3-[4-(2-phenylmethoxyethyl)piperazin-1-yl]propanoic acid);hydrate?
The InChIKey is HTDPMHXZTKRXRL-UHFFFAOYSA-N. The full InChI is InChI=1S/2C16H24N2O3.H2O/c2*19-16(20)6-7-17-8-10-18(11-9-17)12-13-21-14-15-4-2-1-3-5-15;/h2*1-5H,6-14H2,(H,19,20);1H2.
What are the key properties of bis(3-[4-(2-phenylmethoxyethyl)piperazin-1-yl]propanoic acid);hydrate?
bis(3-[4-(2-phenylmethoxyethyl)piperazin-1-yl]propanoic acid);hydrate has a molecular weight of 602.77 g/mol, XLogP of 1.77, 16 rotatable bonds, 2 hydrogen bond donors, and 8 hydrogen bond acceptors.
Where does this data come from?
All data for bis(3-[4-(2-phenylmethoxyethyl)piperazin-1-yl]propanoic acid);hydrate is sourced from PubChem (CID 156599366), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).