C14H21NO2S — CID 24728036
4-(3-phenylmethoxypropyl)-1,4-thiazinane 1-oxide (PubChem CID 24728036) has the molecular formula C14H21NO2S and a molecular weight of 267.39 g/mol. Its IUPAC name is 4-(3-phenylmethoxypropyl)-1,4-thiazinane 1-oxide.
| Compound Name | 4-(3-phenylmethoxypropyl)-1,4-thiazinane 1-oxide |
|---|---|
| PubChem CID | 24728036 |
| Molecular Formula | C14H21NO2S |
| Molecular Weight | 267.39 g/mol |
| Exact Mass | 267.13 |
| IUPAC Name | 4-(3-phenylmethoxypropyl)-1,4-thiazinane 1-oxide |
| SMILES | O=S1CCN(CCCOCc2ccccc2)CC1 |
| InChI | InChI=1S/C14H21NO2S/c16-18-11-8-15(9-12-18)7-4-10-17-13-14-5-2-1-3-6-14/h1-3,5-6H,4,7-13H2 |
| InChIKey | KMASCPIOWDGQES-UHFFFAOYSA-N |
| XLogP | 1.66 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 267.39 |
| LogP ≤ 5 | 1.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|