C20H30N2O2 — CID 137336558
(1-methylcyclopropyl)-[4-(3-phenylmethoxypropyl)-1,4-diazepan-1-yl]methanone (PubChem CID 137336558) has the molecular formula C20H30N2O2 and a molecular weight of 330.47 g/mol. Its IUPAC name is (1-methylcyclopropyl)-[4-(3-phenylmethoxypropyl)-1,4-diazepan-1-yl]methanone.
| Compound Name | (1-methylcyclopropyl)-[4-(3-phenylmethoxypropyl)-1,4-diazepan-1-yl]methanone |
|---|---|
| PubChem CID | 137336558 |
| Molecular Formula | C20H30N2O2 |
| Molecular Weight | 330.47 g/mol |
| Exact Mass | 330.23 |
| IUPAC Name | (1-methylcyclopropyl)-[4-(3-phenylmethoxypropyl)-1,4-diazepan-1-yl]methanone |
| SMILES | CC1(C(=O)N2CCCN(CCCOCc3ccccc3)CC2)CC1 |
| InChI | InChI=1S/C20H30N2O2/c1-20(9-10-20)19(23)22-13-5-11-21(14-15-22)12-6-16-24-17-18-7-3-2-4-8-18/h2-4,7-8H,5-6,9-17H2,1H3 |
| InChIKey | MMNJVSFMAFIKAX-UHFFFAOYSA-N |
| XLogP | 2.93 |
| TPSA | 32.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.47 |
| LogP ≤ 5 | 2.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|