C17H33N3O — CID 106825958
[4-(4-aminobutyl)-1,4-diazepan-1-yl]-(1-methylcyclohexyl)methanone (PubChem CID 106825958) has the molecular formula C17H33N3O and a molecular weight of 295.47 g/mol. Its IUPAC name is [4-(4-aminobutyl)-1,4-diazepan-1-yl]-(1-methylcyclohexyl)methanone.
| Compound Name | [4-(4-aminobutyl)-1,4-diazepan-1-yl]-(1-methylcyclohexyl)methanone |
|---|---|
| PubChem CID | 106825958 |
| Molecular Formula | C17H33N3O |
| Molecular Weight | 295.47 g/mol |
| Exact Mass | 295.26 |
| IUPAC Name | [4-(4-aminobutyl)-1,4-diazepan-1-yl]-(1-methylcyclohexyl)methanone |
| SMILES | CC1(C(=O)N2CCCN(CCCCN)CC2)CCCCC1 |
| InChI | InChI=1S/C17H33N3O/c1-17(8-3-2-4-9-17)16(21)20-13-7-12-19(14-15-20)11-6-5-10-18/h2-15,18H2,1H3 |
| InChIKey | UVAJLKCQQWDQMX-UHFFFAOYSA-N |
| XLogP | 2.23 |
| TPSA | 49.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.47 |
| LogP ≤ 5 | 2.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|