C13H27N3O — CID 43251859
1-[4-(4-aminobutyl)-1,4-diazepan-1-yl]butan-1-one (PubChem CID 43251859) has the molecular formula C13H27N3O and a molecular weight of 241.38 g/mol. Its IUPAC name is 1-[4-(4-aminobutyl)-1,4-diazepan-1-yl]butan-1-one.
| Compound Name | 1-[4-(4-aminobutyl)-1,4-diazepan-1-yl]butan-1-one |
|---|---|
| PubChem CID | 43251859 |
| Molecular Formula | C13H27N3O |
| Molecular Weight | 241.38 g/mol |
| Exact Mass | 241.22 |
| IUPAC Name | 1-[4-(4-aminobutyl)-1,4-diazepan-1-yl]butan-1-one |
| SMILES | CCCC(=O)N1CCCN(CCCCN)CC1 |
| InChI | InChI=1S/C13H27N3O/c1-2-6-13(17)16-10-5-9-15(11-12-16)8-4-3-7-14/h2-12,14H2,1H3 |
| InChIKey | XZKIHWROCCSXAC-UHFFFAOYSA-N |
| XLogP | 1.06 |
| TPSA | 49.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 241.38 |
| LogP ≤ 5 | 1.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|