C12H25N3O2 — CID 43251389
1-[4-(3-aminopropyl)-1,4-diazepan-1-yl]-2-ethoxyethanone (PubChem CID 43251389) has the molecular formula C12H25N3O2 and a molecular weight of 243.35 g/mol. Its IUPAC name is 1-[4-(3-aminopropyl)-1,4-diazepan-1-yl]-2-ethoxyethanone.
| Compound Name | 1-[4-(3-aminopropyl)-1,4-diazepan-1-yl]-2-ethoxyethanone |
|---|---|
| PubChem CID | 43251389 |
| Molecular Formula | C12H25N3O2 |
| Molecular Weight | 243.35 g/mol |
| Exact Mass | 243.19 |
| IUPAC Name | 1-[4-(3-aminopropyl)-1,4-diazepan-1-yl]-2-ethoxyethanone |
| SMILES | CCOCC(=O)N1CCCN(CCCN)CC1 |
| InChI | InChI=1S/C12H25N3O2/c1-2-17-11-12(16)15-8-4-7-14(9-10-15)6-3-5-13/h2-11,13H2,1H3 |
| InChIKey | GKBIXOPKGJLMSY-UHFFFAOYSA-N |
| XLogP | -0.09 |
| TPSA | 58.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 243.35 |
| LogP ≤ 5 | -0.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |