C11H21ClN2O2 — CID 63394368
1-[4-(2-chloroethyl)-1,4-diazepan-1-yl]-2-ethoxyethanone (PubChem CID 63394368) has the molecular formula C11H21ClN2O2 and a molecular weight of 248.75 g/mol. Its IUPAC name is 1-[4-(2-chloroethyl)-1,4-diazepan-1-yl]-2-ethoxyethanone.
| Compound Name | 1-[4-(2-chloroethyl)-1,4-diazepan-1-yl]-2-ethoxyethanone |
|---|---|
| PubChem CID | 63394368 |
| Molecular Formula | C11H21ClN2O2 |
| Molecular Weight | 248.75 g/mol |
| Exact Mass | 248.13 |
| IUPAC Name | 1-[4-(2-chloroethyl)-1,4-diazepan-1-yl]-2-ethoxyethanone |
| SMILES | CCOCC(=O)N1CCCN(CCCl)CC1 |
| InChI | InChI=1S/C11H21ClN2O2/c1-2-16-10-11(15)14-6-3-5-13(7-4-12)8-9-14/h2-10H2,1H3 |
| InChIKey | UJHUECZKFHWKDY-UHFFFAOYSA-N |
| XLogP | 0.80 |
| TPSA | 32.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 248.75 |
| LogP ≤ 5 | 0.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|