C12H21ClN2O — CID 63394830
[4-(2-chloroethyl)-1,4-diazepan-1-yl]-(2-methylcyclopropyl)methanone (PubChem CID 63394830) has the molecular formula C12H21ClN2O and a molecular weight of 244.77 g/mol. Its IUPAC name is [4-(2-chloroethyl)-1,4-diazepan-1-yl]-(2-methylcyclopropyl)methanone.
| Compound Name | [4-(2-chloroethyl)-1,4-diazepan-1-yl]-(2-methylcyclopropyl)methanone |
|---|---|
| PubChem CID | 63394830 |
| Molecular Formula | C12H21ClN2O |
| Molecular Weight | 244.77 g/mol |
| Exact Mass | 244.13 |
| IUPAC Name | [4-(2-chloroethyl)-1,4-diazepan-1-yl]-(2-methylcyclopropyl)methanone |
| SMILES | CC1CC1C(=O)N1CCCN(CCCl)CC1 |
| InChI | InChI=1S/C12H21ClN2O/c1-10-9-11(10)12(16)15-5-2-4-14(6-3-13)7-8-15/h10-11H,2-9H2,1H3 |
| InChIKey | JPDQJZMMVYAZAQ-UHFFFAOYSA-N |
| XLogP | 1.42 |
| TPSA | 23.55 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 244.77 |
| LogP ≤ 5 | 1.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|