C12H27N3O — CID 43457106
3-[4-(2-ethoxyethyl)-1,4-diazepan-1-yl]propan-1-amine (PubChem CID 43457106) has the molecular formula C12H27N3O and a molecular weight of 229.37 g/mol. Its IUPAC name is 3-[4-(2-ethoxyethyl)-1,4-diazepan-1-yl]propan-1-amine.
| Compound Name | 3-[4-(2-ethoxyethyl)-1,4-diazepan-1-yl]propan-1-amine |
|---|---|
| PubChem CID | 43457106 |
| Molecular Formula | C12H27N3O |
| Molecular Weight | 229.37 g/mol |
| Exact Mass | 229.22 |
| IUPAC Name | 3-[4-(2-ethoxyethyl)-1,4-diazepan-1-yl]propan-1-amine |
| SMILES | CCOCCN1CCCN(CCCN)CC1 |
| InChI | InChI=1S/C12H27N3O/c1-2-16-12-11-15-8-4-7-14(9-10-15)6-3-5-13/h2-13H2,1H3 |
| InChIKey | JTFBTJBHXROIGZ-UHFFFAOYSA-N |
| XLogP | 0.38 |
| TPSA | 41.73 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 229.37 |
| LogP ≤ 5 | 0.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|