C15H33N3O — CID 61483102
4-[4-(2-butoxyethyl)-1,4-diazepan-1-yl]butan-1-amine (PubChem CID 61483102) has the molecular formula C15H33N3O and a molecular weight of 271.45 g/mol. Its IUPAC name is 4-[4-(2-butoxyethyl)-1,4-diazepan-1-yl]butan-1-amine.
| Compound Name | 4-[4-(2-butoxyethyl)-1,4-diazepan-1-yl]butan-1-amine |
|---|---|
| PubChem CID | 61483102 |
| Molecular Formula | C15H33N3O |
| Molecular Weight | 271.45 g/mol |
| Exact Mass | 271.26 |
| IUPAC Name | 4-[4-(2-butoxyethyl)-1,4-diazepan-1-yl]butan-1-amine |
| SMILES | CCCCOCCN1CCCN(CCCCN)CC1 |
| InChI | InChI=1S/C15H33N3O/c1-2-3-14-19-15-13-18-10-6-9-17(11-12-18)8-5-4-7-16/h2-16H2,1H3 |
| InChIKey | XYOPFLWLWPHDIL-UHFFFAOYSA-N |
| XLogP | 1.55 |
| TPSA | 41.73 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 271.45 |
| LogP ≤ 5 | 1.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|