C13H29N3O2 — CID 103409181
2-[4-[3-(2-methoxyethoxy)propyl]-1,4-diazepan-1-yl]ethanamine (PubChem CID 103409181) has the molecular formula C13H29N3O2 and a molecular weight of 259.39 g/mol. Its IUPAC name is 2-[4-[3-(2-methoxyethoxy)propyl]-1,4-diazepan-1-yl]ethanamine.
| Compound Name | 2-[4-[3-(2-methoxyethoxy)propyl]-1,4-diazepan-1-yl]ethanamine |
|---|---|
| PubChem CID | 103409181 |
| Molecular Formula | C13H29N3O2 |
| Molecular Weight | 259.39 g/mol |
| Exact Mass | 259.23 |
| IUPAC Name | 2-[4-[3-(2-methoxyethoxy)propyl]-1,4-diazepan-1-yl]ethanamine |
| SMILES | COCCOCCCN1CCCN(CCN)CC1 |
| InChI | InChI=1S/C13H29N3O2/c1-17-12-13-18-11-3-7-15-5-2-6-16(8-4-14)10-9-15/h2-14H2,1H3 |
| InChIKey | DVMBIGMOUHKQLQ-UHFFFAOYSA-N |
| XLogP | 0.01 |
| TPSA | 50.96 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 259.39 |
| LogP ≤ 5 | 0.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|