C13H27ClN2O2 — CID 103183952
1-(2-chloroethyl)-4-[2-(3-methoxypropoxy)ethyl]-1,4-diazepane (PubChem CID 103183952) has the molecular formula C13H27ClN2O2 and a molecular weight of 278.82 g/mol. Its IUPAC name is 1-(2-chloroethyl)-4-[2-(3-methoxypropoxy)ethyl]-1,4-diazepane.
| Compound Name | 1-(2-chloroethyl)-4-[2-(3-methoxypropoxy)ethyl]-1,4-diazepane |
|---|---|
| PubChem CID | 103183952 |
| Molecular Formula | C13H27ClN2O2 |
| Molecular Weight | 278.82 g/mol |
| Exact Mass | 278.18 |
| IUPAC Name | 1-(2-chloroethyl)-4-[2-(3-methoxypropoxy)ethyl]-1,4-diazepane |
| SMILES | COCCCOCCN1CCCN(CCCl)CC1 |
| InChI | InChI=1S/C13H27ClN2O2/c1-17-11-3-12-18-13-10-16-6-2-5-15(7-4-14)8-9-16/h2-13H2,1H3 |
| InChIKey | YQTWBNDUCXSHAE-UHFFFAOYSA-N |
| XLogP | 1.29 |
| TPSA | 24.94 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.82 |
| LogP ≤ 5 | 1.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|