C11H23ClN2 — CID 63387859
1-butyl-4-(2-chloroethyl)-1,4-diazepane (PubChem CID 63387859) has the molecular formula C11H23ClN2 and a molecular weight of 218.77 g/mol. Its IUPAC name is 1-butyl-4-(2-chloroethyl)-1,4-diazepane.
| Compound Name | 1-butyl-4-(2-chloroethyl)-1,4-diazepane |
|---|---|
| PubChem CID | 63387859 |
| Molecular Formula | C11H23ClN2 |
| Molecular Weight | 218.77 g/mol |
| Exact Mass | 218.15 |
| IUPAC Name | 1-butyl-4-(2-chloroethyl)-1,4-diazepane |
| SMILES | CCCCN1CCCN(CCCl)CC1 |
| InChI | InChI=1S/C11H23ClN2/c1-2-3-6-13-7-4-8-14(9-5-12)11-10-13/h2-11H2,1H3 |
| InChIKey | YCVJUHMCARYVFT-UHFFFAOYSA-N |
| XLogP | 2.03 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 218.77 |
| LogP ≤ 5 | 2.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|