2-[4-[3-(2-methoxyethoxy)propyl]-1,4-diazepan-1-yl]acetic acid

C13H26N2O4 — CID 103410865

IUPAC2-[4-[3-(2-methoxyethoxy)propyl]-1,4-diazepan-1-yl]acetic acid
SMILESCOCCOCCCN1CCCN(CC(=O)O)CC1
InChIInChI=1S/C13H26N2O4/c1-18-10-11-19-9-3-6-14-4-2-5-15(8-7-14)12-13(16)17/h2-12H2,1H3,(H,16,17)
InChIKeyUSCNAYRFAZNNLM-UHFFFAOYSA-N
MW274.36 g/mol
LogP0.13
Rot. Bonds9

About 2-[4-[3-(2-methoxyethoxy)propyl]-1,4-diazepan-1-yl]acetic acid

2-[4-[3-(2-methoxyethoxy)propyl]-1,4-diazepan-1-yl]acetic acid (PubChem CID 103410865) has the molecular formula C13H26N2O4 and a molecular weight of 274.36 g/mol. Its IUPAC name is 2-[4-[3-(2-methoxyethoxy)propyl]-1,4-diazepan-1-yl]acetic acid.

Molecular Properties

Compound Name2-[4-[3-(2-methoxyethoxy)propyl]-1,4-diazepan-1-yl]acetic acid
PubChem CID103410865
Molecular FormulaC13H26N2O4
Molecular Weight274.36 g/mol
Exact Mass274.19
IUPAC Name2-[4-[3-(2-methoxyethoxy)propyl]-1,4-diazepan-1-yl]acetic acid
SMILESCOCCOCCCN1CCCN(CC(=O)O)CC1
InChIInChI=1S/C13H26N2O4/c1-18-10-11-19-9-3-6-14-4-2-5-15(8-7-14)12-13(16)17/h2-12H2,1H3,(H,16,17)
InChIKeyUSCNAYRFAZNNLM-UHFFFAOYSA-N
XLogP0.13
TPSA62.24 Ų
H-Bond Donors1
H-Bond Acceptors5
Rotatable Bonds9
Heavy Atoms19
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500274.36
LogP ≤ 50.13
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 105

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}

Analyze 2-[4-[3-(2-methoxyethoxy)propyl]-1,4-diazepan-1-yl]acetic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 2-[4-[3-(2-methoxyethoxy)propyl]-1,4-diazepan-1-yl]acetic acid?
The IUPAC name of 2-[4-[3-(2-methoxyethoxy)propyl]-1,4-diazepan-1-yl]acetic acid (CID 103410865) is 2-[4-[3-(2-methoxyethoxy)propyl]-1,4-diazepan-1-yl]acetic acid.
What is the SMILES notation for 2-[4-[3-(2-methoxyethoxy)propyl]-1,4-diazepan-1-yl]acetic acid?
The canonical SMILES for 2-[4-[3-(2-methoxyethoxy)propyl]-1,4-diazepan-1-yl]acetic acid is COCCOCCCN1CCCN(CC(=O)O)CC1.
What is the InChIKey of 2-[4-[3-(2-methoxyethoxy)propyl]-1,4-diazepan-1-yl]acetic acid?
The InChIKey is USCNAYRFAZNNLM-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H26N2O4/c1-18-10-11-19-9-3-6-14-4-2-5-15(8-7-14)12-13(16)17/h2-12H2,1H3,(H,16,17).
What are the key properties of 2-[4-[3-(2-methoxyethoxy)propyl]-1,4-diazepan-1-yl]acetic acid?
2-[4-[3-(2-methoxyethoxy)propyl]-1,4-diazepan-1-yl]acetic acid has a molecular weight of 274.36 g/mol, XLogP of 0.13, 9 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[4-[3-(2-methoxyethoxy)propyl]-1,4-diazepan-1-yl]acetic acid is sourced from PubChem (CID 103410865), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).