C13H26N2O4 — CID 103410865
2-[4-[3-(2-methoxyethoxy)propyl]-1,4-diazepan-1-yl]acetic acid (PubChem CID 103410865) has the molecular formula C13H26N2O4 and a molecular weight of 274.36 g/mol. Its IUPAC name is 2-[4-[3-(2-methoxyethoxy)propyl]-1,4-diazepan-1-yl]acetic acid.
| Compound Name | 2-[4-[3-(2-methoxyethoxy)propyl]-1,4-diazepan-1-yl]acetic acid |
|---|---|
| PubChem CID | 103410865 |
| Molecular Formula | C13H26N2O4 |
| Molecular Weight | 274.36 g/mol |
| Exact Mass | 274.19 |
| IUPAC Name | 2-[4-[3-(2-methoxyethoxy)propyl]-1,4-diazepan-1-yl]acetic acid |
| SMILES | COCCOCCCN1CCCN(CC(=O)O)CC1 |
| InChI | InChI=1S/C13H26N2O4/c1-18-10-11-19-9-3-6-14-4-2-5-15(8-7-14)12-13(16)17/h2-12H2,1H3,(H,16,17) |
| InChIKey | USCNAYRFAZNNLM-UHFFFAOYSA-N |
| XLogP | 0.13 |
| TPSA | 62.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.36 |
| LogP ≤ 5 | 0.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|