2-(4-butyl-1,4-diazepan-1-yl)acetic acid

C11H22N2O2 — CID 62825221

IUPAC2-(4-butyl-1,4-diazepan-1-yl)acetic acid
SMILESCCCCN1CCCN(CC(=O)O)CC1
InChIInChI=1S/C11H22N2O2/c1-2-3-5-12-6-4-7-13(9-8-12)10-11(14)15/h2-10H2,1H3,(H,14,15)
InChIKeyUFPVQYZECSZFEP-UHFFFAOYSA-N
MW214.31 g/mol
LogP0.88
Rot. Bonds5

About 2-(4-butyl-1,4-diazepan-1-yl)acetic acid

2-(4-butyl-1,4-diazepan-1-yl)acetic acid (PubChem CID 62825221) has the molecular formula C11H22N2O2 and a molecular weight of 214.31 g/mol. Its IUPAC name is 2-(4-butyl-1,4-diazepan-1-yl)acetic acid.

Molecular Properties

Compound Name2-(4-butyl-1,4-diazepan-1-yl)acetic acid
PubChem CID62825221
Molecular FormulaC11H22N2O2
Molecular Weight214.31 g/mol
Exact Mass214.17
IUPAC Name2-(4-butyl-1,4-diazepan-1-yl)acetic acid
SMILESCCCCN1CCCN(CC(=O)O)CC1
InChIInChI=1S/C11H22N2O2/c1-2-3-5-12-6-4-7-13(9-8-12)10-11(14)15/h2-10H2,1H3,(H,14,15)
InChIKeyUFPVQYZECSZFEP-UHFFFAOYSA-N
XLogP0.88
TPSA43.78 Ų
H-Bond Donors1
H-Bond Acceptors3
Rotatable Bonds5
Heavy Atoms15
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500214.31
LogP ≤ 50.88
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 103

Analyze 2-(4-butyl-1,4-diazepan-1-yl)acetic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 2-(4-butyl-1,4-diazepan-1-yl)acetic acid?
The IUPAC name of 2-(4-butyl-1,4-diazepan-1-yl)acetic acid (CID 62825221) is 2-(4-butyl-1,4-diazepan-1-yl)acetic acid.
What is the SMILES notation for 2-(4-butyl-1,4-diazepan-1-yl)acetic acid?
The canonical SMILES for 2-(4-butyl-1,4-diazepan-1-yl)acetic acid is CCCCN1CCCN(CC(=O)O)CC1.
What is the InChIKey of 2-(4-butyl-1,4-diazepan-1-yl)acetic acid?
The InChIKey is UFPVQYZECSZFEP-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H22N2O2/c1-2-3-5-12-6-4-7-13(9-8-12)10-11(14)15/h2-10H2,1H3,(H,14,15).
What are the key properties of 2-(4-butyl-1,4-diazepan-1-yl)acetic acid?
2-(4-butyl-1,4-diazepan-1-yl)acetic acid has a molecular weight of 214.31 g/mol, XLogP of 0.88, 5 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(4-butyl-1,4-diazepan-1-yl)acetic acid is sourced from PubChem (CID 62825221), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).