C11H22N2O2 — CID 62825221
2-(4-butyl-1,4-diazepan-1-yl)acetic acid (PubChem CID 62825221) has the molecular formula C11H22N2O2 and a molecular weight of 214.31 g/mol. Its IUPAC name is 2-(4-butyl-1,4-diazepan-1-yl)acetic acid.
| Compound Name | 2-(4-butyl-1,4-diazepan-1-yl)acetic acid |
|---|---|
| PubChem CID | 62825221 |
| Molecular Formula | C11H22N2O2 |
| Molecular Weight | 214.31 g/mol |
| Exact Mass | 214.17 |
| IUPAC Name | 2-(4-butyl-1,4-diazepan-1-yl)acetic acid |
| SMILES | CCCCN1CCCN(CC(=O)O)CC1 |
| InChI | InChI=1S/C11H22N2O2/c1-2-3-5-12-6-4-7-13(9-8-12)10-11(14)15/h2-10H2,1H3,(H,14,15) |
| InChIKey | UFPVQYZECSZFEP-UHFFFAOYSA-N |
| XLogP | 0.88 |
| TPSA | 43.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 214.31 |
| LogP ≤ 5 | 0.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |