C14H26N2O3 — CID 114246008
2-[4-(2-methylhexanoyl)-1,4-diazepan-1-yl]acetic acid (PubChem CID 114246008) has the molecular formula C14H26N2O3 and a molecular weight of 270.37 g/mol. Its IUPAC name is 2-[4-(2-methylhexanoyl)-1,4-diazepan-1-yl]acetic acid.
| Compound Name | 2-[4-(2-methylhexanoyl)-1,4-diazepan-1-yl]acetic acid |
|---|---|
| PubChem CID | 114246008 |
| Molecular Formula | C14H26N2O3 |
| Molecular Weight | 270.37 g/mol |
| Exact Mass | 270.19 |
| IUPAC Name | 2-[4-(2-methylhexanoyl)-1,4-diazepan-1-yl]acetic acid |
| SMILES | CCCCC(C)C(=O)N1CCCN(CC(=O)O)CC1 |
| InChI | InChI=1S/C14H26N2O3/c1-3-4-6-12(2)14(19)16-8-5-7-15(9-10-16)11-13(17)18/h12H,3-11H2,1-2H3,(H,17,18) |
| InChIKey | MKEWEHXDVRUZKU-UHFFFAOYSA-N |
| XLogP | 1.43 |
| TPSA | 60.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.37 |
| LogP ≤ 5 | 1.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |