C10H19N3O3 — CID 62825178
2-[4-(dimethylcarbamoyl)-1,4-diazepan-1-yl]acetic acid (PubChem CID 62825178) has the molecular formula C10H19N3O3 and a molecular weight of 229.28 g/mol. Its IUPAC name is 2-[4-(dimethylcarbamoyl)-1,4-diazepan-1-yl]acetic acid.
| Compound Name | 2-[4-(dimethylcarbamoyl)-1,4-diazepan-1-yl]acetic acid |
|---|---|
| PubChem CID | 62825178 |
| Molecular Formula | C10H19N3O3 |
| Molecular Weight | 229.28 g/mol |
| Exact Mass | 229.14 |
| IUPAC Name | 2-[4-(dimethylcarbamoyl)-1,4-diazepan-1-yl]acetic acid |
| SMILES | CN(C)C(=O)N1CCCN(CC(=O)O)CC1 |
| InChI | InChI=1S/C10H19N3O3/c1-11(2)10(16)13-5-3-4-12(6-7-13)8-9(14)15/h3-8H2,1-2H3,(H,14,15) |
| InChIKey | QVYGOCKKWXQTFB-UHFFFAOYSA-N |
| XLogP | -0.24 |
| TPSA | 64.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 229.28 |
| LogP ≤ 5 | -0.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |