2-(4-propan-2-yloxycarbonyl-1,4-diazepan-1-yl)acetic acid

C11H20N2O4 — CID 55119006

IUPAC2-(4-propan-2-yloxycarbonyl-1,4-diazepan-1-yl)acetic acid
SMILESCC(C)OC(=O)N1CCCN(CC(=O)O)CC1
InChIInChI=1S/C11H20N2O4/c1-9(2)17-11(16)13-5-3-4-12(6-7-13)8-10(14)15/h9H,3-8H2,1-2H3,(H,14,15)
InChIKeyGKGRUUWOVOFWIS-UHFFFAOYSA-N
MW244.29 g/mol
LogP0.62
Rot. Bonds3

About 2-(4-propan-2-yloxycarbonyl-1,4-diazepan-1-yl)acetic acid

2-(4-propan-2-yloxycarbonyl-1,4-diazepan-1-yl)acetic acid (PubChem CID 55119006) has the molecular formula C11H20N2O4 and a molecular weight of 244.29 g/mol. Its IUPAC name is 2-(4-propan-2-yloxycarbonyl-1,4-diazepan-1-yl)acetic acid.

Molecular Properties

Compound Name2-(4-propan-2-yloxycarbonyl-1,4-diazepan-1-yl)acetic acid
PubChem CID55119006
Molecular FormulaC11H20N2O4
Molecular Weight244.29 g/mol
Exact Mass244.14
IUPAC Name2-(4-propan-2-yloxycarbonyl-1,4-diazepan-1-yl)acetic acid
SMILESCC(C)OC(=O)N1CCCN(CC(=O)O)CC1
InChIInChI=1S/C11H20N2O4/c1-9(2)17-11(16)13-5-3-4-12(6-7-13)8-10(14)15/h9H,3-8H2,1-2H3,(H,14,15)
InChIKeyGKGRUUWOVOFWIS-UHFFFAOYSA-N
XLogP0.62
TPSA70.08 Ų
H-Bond Donors1
H-Bond Acceptors4
Rotatable Bonds3
Heavy Atoms17
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500244.29
LogP ≤ 50.62
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 104

Analyze 2-(4-propan-2-yloxycarbonyl-1,4-diazepan-1-yl)acetic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 2-(4-propan-2-yloxycarbonyl-1,4-diazepan-1-yl)acetic acid?
The IUPAC name of 2-(4-propan-2-yloxycarbonyl-1,4-diazepan-1-yl)acetic acid (CID 55119006) is 2-(4-propan-2-yloxycarbonyl-1,4-diazepan-1-yl)acetic acid.
What is the SMILES notation for 2-(4-propan-2-yloxycarbonyl-1,4-diazepan-1-yl)acetic acid?
The canonical SMILES for 2-(4-propan-2-yloxycarbonyl-1,4-diazepan-1-yl)acetic acid is CC(C)OC(=O)N1CCCN(CC(=O)O)CC1.
What is the InChIKey of 2-(4-propan-2-yloxycarbonyl-1,4-diazepan-1-yl)acetic acid?
The InChIKey is GKGRUUWOVOFWIS-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H20N2O4/c1-9(2)17-11(16)13-5-3-4-12(6-7-13)8-10(14)15/h9H,3-8H2,1-2H3,(H,14,15).
What are the key properties of 2-(4-propan-2-yloxycarbonyl-1,4-diazepan-1-yl)acetic acid?
2-(4-propan-2-yloxycarbonyl-1,4-diazepan-1-yl)acetic acid has a molecular weight of 244.29 g/mol, XLogP of 0.62, 3 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(4-propan-2-yloxycarbonyl-1,4-diazepan-1-yl)acetic acid is sourced from PubChem (CID 55119006), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).