C15H30N4O2 — CID 65292332
2-[4-(6-amino-2-methylheptanoyl)-1,4-diazepan-1-yl]acetamide (PubChem CID 65292332) has the molecular formula C15H30N4O2 and a molecular weight of 298.43 g/mol. Its IUPAC name is 2-[4-(6-amino-2-methylheptanoyl)-1,4-diazepan-1-yl]acetamide.
| Compound Name | 2-[4-(6-amino-2-methylheptanoyl)-1,4-diazepan-1-yl]acetamide |
|---|---|
| PubChem CID | 65292332 |
| Molecular Formula | C15H30N4O2 |
| Molecular Weight | 298.43 g/mol |
| Exact Mass | 298.24 |
| IUPAC Name | 2-[4-(6-amino-2-methylheptanoyl)-1,4-diazepan-1-yl]acetamide |
| SMILES | CC(N)CCCC(C)C(=O)N1CCCN(CC(N)=O)CC1 |
| InChI | InChI=1S/C15H30N4O2/c1-12(5-3-6-13(2)16)15(21)19-8-4-7-18(9-10-19)11-14(17)20/h12-13H,3-11,16H2,1-2H3,(H2,17,20) |
| InChIKey | PVYRPCWRQOQIMP-UHFFFAOYSA-N |
| XLogP | 0.16 |
| TPSA | 92.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.43 |
| LogP ≤ 5 | 0.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |