C18H34N4O8 — CID 19438545
2-[4,7-bis(carboxymethyl)-10-[2-(2-hydroxyethoxy)ethyl]-1,4,7,10-tetrazacyclododec-1-yl]acetic acid (PubChem CID 19438545) has the molecular formula C18H34N4O8 and a molecular weight of 434.49 g/mol. Its IUPAC name is 2-[4,7-bis(carboxymethyl)-10-[2-(2-hydroxyethoxy)ethyl]-1,4,7,10-tetrazacyclododec-1-yl]acetic acid.
| Compound Name | 2-[4,7-bis(carboxymethyl)-10-[2-(2-hydroxyethoxy)ethyl]-1,4,7,10-tetrazacyclododec-1-yl]acetic acid |
|---|---|
| PubChem CID | 19438545 |
| Molecular Formula | C18H34N4O8 |
| Molecular Weight | 434.49 g/mol |
| Exact Mass | 434.24 |
| IUPAC Name | 2-[4,7-bis(carboxymethyl)-10-[2-(2-hydroxyethoxy)ethyl]-1,4,7,10-tetrazacyclododec-1-yl]acetic acid |
| SMILES | O=C(O)CN1CCN(CCOCCO)CCN(CC(=O)O)CCN(CC(=O)O)CC1 |
| InChI | InChI=1S/C18H34N4O8/c23-10-12-30-11-9-19-1-3-20(13-16(24)25)5-7-22(15-18(28)29)8-6-21(4-2-19)14-17(26)27/h23H,1-15H2,(H,24,25)(H,26,27)(H,28,29) |
| InChIKey | VDGSJUFEDZPOOG-UHFFFAOYSA-N |
| XLogP | -2.53 |
| TPSA | 154.32 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.49 |
| LogP ≤ 5 | -2.53 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|