C16H34N4O6 — CID 54082006
2-[4-ethyl-7,10-bis(2-hydroperoxyethyl)-1,4,7,10-tetrazacyclododec-1-yl]acetic acid (PubChem CID 54082006) has the molecular formula C16H34N4O6 and a molecular weight of 378.47 g/mol. Its IUPAC name is 2-[4-ethyl-7,10-bis(2-hydroperoxyethyl)-1,4,7,10-tetrazacyclododec-1-yl]acetic acid.
| Compound Name | 2-[4-ethyl-7,10-bis(2-hydroperoxyethyl)-1,4,7,10-tetrazacyclododec-1-yl]acetic acid |
|---|---|
| PubChem CID | 54082006 |
| Molecular Formula | C16H34N4O6 |
| Molecular Weight | 378.47 g/mol |
| Exact Mass | 378.25 |
| IUPAC Name | 2-[4-ethyl-7,10-bis(2-hydroperoxyethyl)-1,4,7,10-tetrazacyclododec-1-yl]acetic acid |
| SMILES | CCN1CCN(CCOO)CCN(CCOO)CCN(CC(=O)O)CC1 |
| InChI | InChI=1S/C16H34N4O6/c1-2-17-3-5-18(11-13-25-23)6-7-19(12-14-26-24)8-10-20(9-4-17)15-16(21)22/h23-24H,2-15H2,1H3,(H,21,22) |
| InChIKey | MNUBFXVNIFAVSC-UHFFFAOYSA-N |
| XLogP | -0.71 |
| TPSA | 109.18 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.47 |
| LogP ≤ 5 | -0.71 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|