C11H23N3O2 — CID 159982673
2-(4-ethyl-7-methyl-1,4,7-triazonan-1-yl)acetic acid (PubChem CID 159982673) has the molecular formula C11H23N3O2 and a molecular weight of 229.32 g/mol. Its IUPAC name is 2-(4-ethyl-7-methyl-1,4,7-triazonan-1-yl)acetic acid.
| Compound Name | 2-(4-ethyl-7-methyl-1,4,7-triazonan-1-yl)acetic acid |
|---|---|
| PubChem CID | 159982673 |
| Molecular Formula | C11H23N3O2 |
| Molecular Weight | 229.32 g/mol |
| Exact Mass | 229.18 |
| IUPAC Name | 2-(4-ethyl-7-methyl-1,4,7-triazonan-1-yl)acetic acid |
| SMILES | CCN1CCN(C)CCN(CC(=O)O)CC1 |
| InChI | InChI=1S/C11H23N3O2/c1-3-13-6-4-12(2)5-7-14(9-8-13)10-11(15)16/h3-10H2,1-2H3,(H,15,16) |
| InChIKey | OCCXWCIYURAEKP-UHFFFAOYSA-N |
| XLogP | -0.36 |
| TPSA | 47.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 229.32 |
| LogP ≤ 5 | -0.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |