2-(4-ethyl-7-methyl-1,4,7-triazonan-1-yl)acetic acid

C11H23N3O2 — CID 159982673

IUPAC2-(4-ethyl-7-methyl-1,4,7-triazonan-1-yl)acetic acid
SMILESCCN1CCN(C)CCN(CC(=O)O)CC1
InChIInChI=1S/C11H23N3O2/c1-3-13-6-4-12(2)5-7-14(9-8-13)10-11(15)16/h3-10H2,1-2H3,(H,15,16)
InChIKeyOCCXWCIYURAEKP-UHFFFAOYSA-N
MW229.32 g/mol
LogP-0.36
Rot. Bonds3

About 2-(4-ethyl-7-methyl-1,4,7-triazonan-1-yl)acetic acid

2-(4-ethyl-7-methyl-1,4,7-triazonan-1-yl)acetic acid (PubChem CID 159982673) has the molecular formula C11H23N3O2 and a molecular weight of 229.32 g/mol. Its IUPAC name is 2-(4-ethyl-7-methyl-1,4,7-triazonan-1-yl)acetic acid.

Molecular Properties

Compound Name2-(4-ethyl-7-methyl-1,4,7-triazonan-1-yl)acetic acid
PubChem CID159982673
Molecular FormulaC11H23N3O2
Molecular Weight229.32 g/mol
Exact Mass229.18
IUPAC Name2-(4-ethyl-7-methyl-1,4,7-triazonan-1-yl)acetic acid
SMILESCCN1CCN(C)CCN(CC(=O)O)CC1
InChIInChI=1S/C11H23N3O2/c1-3-13-6-4-12(2)5-7-14(9-8-13)10-11(15)16/h3-10H2,1-2H3,(H,15,16)
InChIKeyOCCXWCIYURAEKP-UHFFFAOYSA-N
XLogP-0.36
TPSA47.02 Ų
H-Bond Donors1
H-Bond Acceptors4
Rotatable Bonds3
Heavy Atoms16
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500229.32
LogP ≤ 5-0.36
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 104

Analyze 2-(4-ethyl-7-methyl-1,4,7-triazonan-1-yl)acetic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 2-(4-ethyl-7-methyl-1,4,7-triazonan-1-yl)acetic acid?
The IUPAC name of 2-(4-ethyl-7-methyl-1,4,7-triazonan-1-yl)acetic acid (CID 159982673) is 2-(4-ethyl-7-methyl-1,4,7-triazonan-1-yl)acetic acid.
What is the SMILES notation for 2-(4-ethyl-7-methyl-1,4,7-triazonan-1-yl)acetic acid?
The canonical SMILES for 2-(4-ethyl-7-methyl-1,4,7-triazonan-1-yl)acetic acid is CCN1CCN(C)CCN(CC(=O)O)CC1.
What is the InChIKey of 2-(4-ethyl-7-methyl-1,4,7-triazonan-1-yl)acetic acid?
The InChIKey is OCCXWCIYURAEKP-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H23N3O2/c1-3-13-6-4-12(2)5-7-14(9-8-13)10-11(15)16/h3-10H2,1-2H3,(H,15,16).
What are the key properties of 2-(4-ethyl-7-methyl-1,4,7-triazonan-1-yl)acetic acid?
2-(4-ethyl-7-methyl-1,4,7-triazonan-1-yl)acetic acid has a molecular weight of 229.32 g/mol, XLogP of -0.36, 3 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(4-ethyl-7-methyl-1,4,7-triazonan-1-yl)acetic acid is sourced from PubChem (CID 159982673), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).