C10H22N3O3P — CID 177187558
2-[4-[hydroxy(methyl)phosphanyl]-7-methyl-1,4,7-triazonan-1-yl]acetic acid (PubChem CID 177187558) has the molecular formula C10H22N3O3P and a molecular weight of 263.28 g/mol. Its IUPAC name is 2-[4-[hydroxy(methyl)phosphanyl]-7-methyl-1,4,7-triazonan-1-yl]acetic acid.
| Compound Name | 2-[4-[hydroxy(methyl)phosphanyl]-7-methyl-1,4,7-triazonan-1-yl]acetic acid |
|---|---|
| PubChem CID | 177187558 |
| Molecular Formula | C10H22N3O3P |
| Molecular Weight | 263.28 g/mol |
| Exact Mass | 263.14 |
| IUPAC Name | 2-[4-[hydroxy(methyl)phosphanyl]-7-methyl-1,4,7-triazonan-1-yl]acetic acid |
| SMILES | CN1CCN(CC(=O)O)CCN(P(C)O)CC1 |
| InChI | InChI=1S/C10H22N3O3P/c1-11-3-5-12(9-10(14)15)6-8-13(7-4-11)17(2)16/h16H,3-9H2,1-2H3,(H,14,15) |
| InChIKey | XSNAGCLGPVQMBQ-UHFFFAOYSA-N |
| XLogP | -0.45 |
| TPSA | 67.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 263.28 |
| LogP ≤ 5 | -0.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|