C12H23N5O3 — CID 83019678
2-[4-[(4-methylpiperazin-1-yl)carbamoyl]piperazin-1-yl]acetic acid (PubChem CID 83019678) has the molecular formula C12H23N5O3 and a molecular weight of 285.35 g/mol. Its IUPAC name is 2-[4-[(4-methylpiperazin-1-yl)carbamoyl]piperazin-1-yl]acetic acid.
| Compound Name | 2-[4-[(4-methylpiperazin-1-yl)carbamoyl]piperazin-1-yl]acetic acid |
|---|---|
| PubChem CID | 83019678 |
| Molecular Formula | C12H23N5O3 |
| Molecular Weight | 285.35 g/mol |
| Exact Mass | 285.18 |
| IUPAC Name | 2-[4-[(4-methylpiperazin-1-yl)carbamoyl]piperazin-1-yl]acetic acid |
| SMILES | CN1CCN(NC(=O)N2CCN(CC(=O)O)CC2)CC1 |
| InChI | InChI=1S/C12H23N5O3/c1-14-2-8-17(9-3-14)13-12(20)16-6-4-15(5-7-16)10-11(18)19/h2-10H2,1H3,(H,13,20)(H,18,19) |
| InChIKey | AGZUBEBILHIVNE-UHFFFAOYSA-N |
| XLogP | -1.44 |
| TPSA | 79.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.35 |
| LogP ≤ 5 | -1.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |