C11H22N4O4S — CID 119134673
2-[4-(4-methylpiperazin-1-yl)sulfonylpiperazin-1-yl]acetic acid (PubChem CID 119134673) has the molecular formula C11H22N4O4S and a molecular weight of 306.39 g/mol. Its IUPAC name is 2-[4-(4-methylpiperazin-1-yl)sulfonylpiperazin-1-yl]acetic acid.
| Compound Name | 2-[4-(4-methylpiperazin-1-yl)sulfonylpiperazin-1-yl]acetic acid |
|---|---|
| PubChem CID | 119134673 |
| Molecular Formula | C11H22N4O4S |
| Molecular Weight | 306.39 g/mol |
| Exact Mass | 306.14 |
| IUPAC Name | 2-[4-(4-methylpiperazin-1-yl)sulfonylpiperazin-1-yl]acetic acid |
| SMILES | CN1CCN(S(=O)(=O)N2CCN(CC(=O)O)CC2)CC1 |
| InChI | InChI=1S/C11H22N4O4S/c1-12-2-6-14(7-3-12)20(18,19)15-8-4-13(5-9-15)10-11(16)17/h2-10H2,1H3,(H,16,17) |
| InChIKey | GMTOXVKHKMGCHU-UHFFFAOYSA-N |
| XLogP | -1.82 |
| TPSA | 84.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.39 |
| LogP ≤ 5 | -1.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |