C15H32N4O6 — CID 22943955
2-[4,7-bis(2-hydroperoxyethyl)-10-methyl-1,4,7,10-tetrazacyclododec-1-yl]acetic acid (PubChem CID 22943955) has the molecular formula C15H32N4O6 and a molecular weight of 364.44 g/mol. Its IUPAC name is 2-[4,7-bis(2-hydroperoxyethyl)-10-methyl-1,4,7,10-tetrazacyclododec-1-yl]acetic acid.
| Compound Name | 2-[4,7-bis(2-hydroperoxyethyl)-10-methyl-1,4,7,10-tetrazacyclododec-1-yl]acetic acid |
|---|---|
| PubChem CID | 22943955 |
| Molecular Formula | C15H32N4O6 |
| Molecular Weight | 364.44 g/mol |
| Exact Mass | 364.23 |
| IUPAC Name | 2-[4,7-bis(2-hydroperoxyethyl)-10-methyl-1,4,7,10-tetrazacyclododec-1-yl]acetic acid |
| SMILES | CN1CCN(CCOO)CCN(CCOO)CCN(CC(=O)O)CC1 |
| InChI | InChI=1S/C15H32N4O6/c1-16-2-4-17(10-12-24-22)6-7-18(11-13-25-23)8-9-19(5-3-16)14-15(20)21/h22-23H,2-14H2,1H3,(H,20,21) |
| InChIKey | CZGXHAUQNSNKKU-UHFFFAOYSA-N |
| XLogP | -1.10 |
| TPSA | 109.18 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.44 |
| LogP ≤ 5 | -1.10 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|