About ethane;2-[2-(4-pentylpiperazin-1-yl)ethoxy]ethanol;tungsten
ethane;2-[2-(4-pentylpiperazin-1-yl)ethoxy]ethanol;tungsten (PubChem CID 156720121) has the molecular formula C17H40N2O2W
and a molecular weight of 488.36 g/mol. Its IUPAC name is ethane;2-[2-(4-pentylpiperazin-1-yl)ethoxy]ethanol;tungsten.
Molecular Properties
| Compound Name | ethane;2-[2-(4-pentylpiperazin-1-yl)ethoxy]ethanol;tungsten |
| PubChem CID | 156720121 |
| Molecular Formula | C17H40N2O2W |
| Molecular Weight | 488.36 g/mol |
| Exact Mass | 488.26 |
| IUPAC Name | ethane;2-[2-(4-pentylpiperazin-1-yl)ethoxy]ethanol;tungsten |
| SMILES | CC.CC.CCCCCN1CCN(CCOCCO)CC1.[W] |
| InChI | InChI=1S/C13H28N2O2.2C2H6.W/c1-2-3-4-5-14-6-8-15(9-7-14)10-12-17-13-11-16;2*1-2;/h16H,2-13H2,1H3;2*1-2H3; |
| InChIKey | USAPWZSAVFYEIS-UHFFFAOYSA-N |
| XLogP | 2.85 |
| TPSA | 35.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 488.36 |
| LogP ≤ 5 | 2.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze ethane;2-[2-(4-pentylpiperazin-1-yl)ethoxy]ethanol;tungsten with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethane;2-[2-(4-pentylpiperazin-1-yl)ethoxy]ethanol;tungsten?
The IUPAC name of ethane;2-[2-(4-pentylpiperazin-1-yl)ethoxy]ethanol;tungsten (CID 156720121) is ethane;2-[2-(4-pentylpiperazin-1-yl)ethoxy]ethanol;tungsten.
What is the SMILES notation for ethane;2-[2-(4-pentylpiperazin-1-yl)ethoxy]ethanol;tungsten?
The canonical SMILES for ethane;2-[2-(4-pentylpiperazin-1-yl)ethoxy]ethanol;tungsten is CC.CC.CCCCCN1CCN(CCOCCO)CC1.[W].
What is the InChIKey of ethane;2-[2-(4-pentylpiperazin-1-yl)ethoxy]ethanol;tungsten?
The InChIKey is USAPWZSAVFYEIS-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H28N2O2.2C2H6.W/c1-2-3-4-5-14-6-8-15(9-7-14)10-12-17-13-11-16;2*1-2;/h16H,2-13H2,1H3;2*1-2H3;.
What are the key properties of ethane;2-[2-(4-pentylpiperazin-1-yl)ethoxy]ethanol;tungsten?
ethane;2-[2-(4-pentylpiperazin-1-yl)ethoxy]ethanol;tungsten has a molecular weight of 488.36 g/mol, XLogP of 2.85, 9 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for ethane;2-[2-(4-pentylpiperazin-1-yl)ethoxy]ethanol;tungsten is sourced from PubChem (CID 156720121), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).