C14H31N3O — CID 54958260
4-[4-(2-propan-2-yloxyethyl)-1,4-diazepan-1-yl]butan-1-amine (PubChem CID 54958260) has the molecular formula C14H31N3O and a molecular weight of 257.42 g/mol. Its IUPAC name is 4-[4-(2-propan-2-yloxyethyl)-1,4-diazepan-1-yl]butan-1-amine.
| Compound Name | 4-[4-(2-propan-2-yloxyethyl)-1,4-diazepan-1-yl]butan-1-amine |
|---|---|
| PubChem CID | 54958260 |
| Molecular Formula | C14H31N3O |
| Molecular Weight | 257.42 g/mol |
| Exact Mass | 257.25 |
| IUPAC Name | 4-[4-(2-propan-2-yloxyethyl)-1,4-diazepan-1-yl]butan-1-amine |
| SMILES | CC(C)OCCN1CCCN(CCCCN)CC1 |
| InChI | InChI=1S/C14H31N3O/c1-14(2)18-13-12-17-9-5-8-16(10-11-17)7-4-3-6-15/h14H,3-13,15H2,1-2H3 |
| InChIKey | ONZXEEWDWATAEV-UHFFFAOYSA-N |
| XLogP | 1.16 |
| TPSA | 41.73 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 257.42 |
| LogP ≤ 5 | 1.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|