C12H25N3O — CID 43251686
1-[4-(2-aminoethyl)-1,4-diazepan-1-yl]pentan-1-one (PubChem CID 43251686) has the molecular formula C12H25N3O and a molecular weight of 227.35 g/mol. Its IUPAC name is 1-[4-(2-aminoethyl)-1,4-diazepan-1-yl]pentan-1-one.
| Compound Name | 1-[4-(2-aminoethyl)-1,4-diazepan-1-yl]pentan-1-one |
|---|---|
| PubChem CID | 43251686 |
| Molecular Formula | C12H25N3O |
| Molecular Weight | 227.35 g/mol |
| Exact Mass | 227.20 |
| IUPAC Name | 1-[4-(2-aminoethyl)-1,4-diazepan-1-yl]pentan-1-one |
| SMILES | CCCCC(=O)N1CCCN(CCN)CC1 |
| InChI | InChI=1S/C12H25N3O/c1-2-3-5-12(16)15-8-4-7-14(9-6-13)10-11-15/h2-11,13H2,1H3 |
| InChIKey | SEPNMZFQICANGA-UHFFFAOYSA-N |
| XLogP | 0.67 |
| TPSA | 49.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 227.35 |
| LogP ≤ 5 | 0.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |