C25H48N2O2 — CID 4155089
1-(4-decanoyl-1,4-diazepan-1-yl)decan-1-one (PubChem CID 4155089) has the molecular formula C25H48N2O2 and a molecular weight of 408.67 g/mol. Its IUPAC name is 1-(4-decanoyl-1,4-diazepan-1-yl)decan-1-one.
| Compound Name | 1-(4-decanoyl-1,4-diazepan-1-yl)decan-1-one |
|---|---|
| PubChem CID | 4155089 |
| Molecular Formula | C25H48N2O2 |
| Molecular Weight | 408.67 g/mol |
| Exact Mass | 408.37 |
| IUPAC Name | 1-(4-decanoyl-1,4-diazepan-1-yl)decan-1-one |
| SMILES | CCCCCCCCCC(=O)N1CCCN(C(=O)CCCCCCCCC)CC1 |
| InChI | InChI=1S/C25H48N2O2/c1-3-5-7-9-11-13-15-18-24(28)26-20-17-21-27(23-22-26)25(29)19-16-14-12-10-8-6-4-2/h3-23H2,1-2H3 |
| InChIKey | PMXKGIJZMHJHJV-UHFFFAOYSA-N |
| XLogP | 6.33 |
| TPSA | 40.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.67 |
| LogP ≤ 5 | 6.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|