C42H78N6O6 — CID 603333
1-[4,7,10,13,16-penta(pentanoyl)-1,4,7,10,13,16-hexazacyclooctadec-1-yl]pentan-1-one (PubChem CID 603333) has the molecular formula C42H78N6O6 and a molecular weight of 763.12 g/mol. Its IUPAC name is 1-[4,7,10,13,16-penta(pentanoyl)-1,4,7,10,13,16-hexazacyclooctadec-1-yl]pentan-1-one.
| Compound Name | 1-[4,7,10,13,16-penta(pentanoyl)-1,4,7,10,13,16-hexazacyclooctadec-1-yl]pentan-1-one |
|---|---|
| PubChem CID | 603333 |
| Molecular Formula | C42H78N6O6 |
| Molecular Weight | 763.12 g/mol |
| Exact Mass | 762.60 |
| IUPAC Name | 1-[4,7,10,13,16-penta(pentanoyl)-1,4,7,10,13,16-hexazacyclooctadec-1-yl]pentan-1-one |
| SMILES | CCCCC(=O)N1CCN(C(=O)CCCC)CCN(C(=O)CCCC)CCN(C(=O)CCCC)CCN(C(=O)CCCC)CCN(C(=O)CCCC)CC1 |
| InChI | InChI=1S/C42H78N6O6/c1-7-13-19-37(49)43-25-27-44(38(50)20-14-8-2)29-31-46(40(52)22-16-10-4)33-35-48(42(54)24-18-12-6)36-34-47(41(53)23-17-11-5)32-30-45(28-26-43)39(51)21-15-9-3/h7-36H2,1-6H3 |
| InChIKey | QPBAZBVSUGLXQH-UHFFFAOYSA-N |
| XLogP | 6.11 |
| TPSA | 121.86 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 54 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 763.12 |
| LogP ≤ 5 | 6.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |